About 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine
2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine (PubChem CID 84815368) has the molecular formula C15H22N2O2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine |
| PubChem CID | 84815368 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine |
| SMILES | NCCc1cccc(CCN2CC3CC(C2)S3(=O)=O)c1 |
| InChI | InChI=1S/C15H22N2O2S/c16-6-4-12-2-1-3-13(8-12)5-7-17-10-14-9-15(11-17)20(14,18)19/h1-3,8,14-15H,4-7,9-11,16H2 |
| InChIKey | KBJJBYFZKYHYEG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine?
The IUPAC name of 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine (CID 84815368) is 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine.
What is the SMILES notation for 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine?
The canonical SMILES for 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine is NCCc1cccc(CCN2CC3CC(C2)S3(=O)=O)c1.
What is the InChIKey of 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine?
The InChIKey is KBJJBYFZKYHYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2S/c16-6-4-12-2-1-3-13(8-12)5-7-17-10-14-9-15(11-17)20(14,18)19/h1-3,8,14-15H,4-7,9-11,16H2.
What are the key properties of 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine?
2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine has a molecular weight of 294.42 g/mol, XLogP of 0.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(6,6-dioxo-6λ6-thia-3-azabicyclo[3.1.1]heptan-3-yl)ethyl]phenyl]ethanamine is sourced from PubChem (CID 84815368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).