4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid

C9H14F2O4S — CID 84805322

IUPAC4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid
SMILESCCCC1(C(=O)O)CS(=O)(=O)CCC1(F)F
InChIInChI=1S/C9H14F2O4S/c1-2-3-8(7(12)13)6-16(14,15)5-4-9(8,10)11/h2-6H2,1H3,(H,12,13)
InChIKeyZJKZXULHJRVNGZ-UHFFFAOYSA-N
MW256.27 g/mol
LogP1.31
Rot. Bonds3

About 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid

4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid (PubChem CID 84805322) has the molecular formula C9H14F2O4S and a molecular weight of 256.27 g/mol. Its IUPAC name is 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid.

Molecular Properties

Compound Name4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid
PubChem CID84805322
Molecular FormulaC9H14F2O4S
Molecular Weight256.27 g/mol
Exact Mass256.06
IUPAC Name4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid
SMILESCCCC1(C(=O)O)CS(=O)(=O)CCC1(F)F
InChIInChI=1S/C9H14F2O4S/c1-2-3-8(7(12)13)6-16(14,15)5-4-9(8,10)11/h2-6H2,1H3,(H,12,13)
InChIKeyZJKZXULHJRVNGZ-UHFFFAOYSA-N
XLogP1.31
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.27
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid?
The IUPAC name of 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid (CID 84805322) is 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid.
What is the SMILES notation for 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid?
The canonical SMILES for 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid is CCCC1(C(=O)O)CS(=O)(=O)CCC1(F)F.
What is the InChIKey of 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid?
The InChIKey is ZJKZXULHJRVNGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O4S/c1-2-3-8(7(12)13)6-16(14,15)5-4-9(8,10)11/h2-6H2,1H3,(H,12,13).
What are the key properties of 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid?
4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid has a molecular weight of 256.27 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-1,1-dioxo-3-propylthiane-3-carboxylic acid is sourced from PubChem (CID 84805322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).