C7H9F3O4S — CID 83919616
1,1-dioxo-4-(trifluoromethyl)thiane-4-carboxylic acid (PubChem CID 83919616) has the molecular formula C7H9F3O4S and a molecular weight of 246.21 g/mol. Its IUPAC name is 1,1-dioxo-4-(trifluoromethyl)thiane-4-carboxylic acid.
| Compound Name | 1,1-dioxo-4-(trifluoromethyl)thiane-4-carboxylic acid |
|---|---|
| PubChem CID | 83919616 |
| Molecular Formula | C7H9F3O4S |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 1,1-dioxo-4-(trifluoromethyl)thiane-4-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H9F3O4S/c8-7(9,10)6(5(11)12)1-3-15(13,14)4-2-6/h1-4H2,(H,11,12) |
| InChIKey | WMBYYZAWCWJEHV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |