C16H14ClNO5S — CID 84819728
2-ethoxy-5-[(4-formylbenzoyl)amino]benzenesulfonyl chloride (PubChem CID 84819728) has the molecular formula C16H14ClNO5S and a molecular weight of 367.81 g/mol. Its IUPAC name is 2-ethoxy-5-[(4-formylbenzoyl)amino]benzenesulfonyl chloride.
| Compound Name | 2-ethoxy-5-[(4-formylbenzoyl)amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 84819728 |
| Molecular Formula | C16H14ClNO5S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-ethoxy-5-[(4-formylbenzoyl)amino]benzenesulfonyl chloride |
| SMILES | CCOc1ccc(NC(=O)c2ccc(C=O)cc2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C16H14ClNO5S/c1-2-23-14-8-7-13(9-15(14)24(17,21)22)18-16(20)12-5-3-11(10-19)4-6-12/h3-10H,2H2,1H3,(H,18,20) |
| InChIKey | RUXFEKGAYVFIGX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|