C16H15ClN2O6S — CID 8506214
methyl 2-[[[2-(2-chlorophenoxy)acetyl]amino]sulfamoyl]benzoate (PubChem CID 8506214) has the molecular formula C16H15ClN2O6S and a molecular weight of 398.82 g/mol. Its IUPAC name is methyl 2-[[[2-(2-chlorophenoxy)acetyl]amino]sulfamoyl]benzoate.
| Compound Name | methyl 2-[[[2-(2-chlorophenoxy)acetyl]amino]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 8506214 |
| Molecular Formula | C16H15ClN2O6S |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | methyl 2-[[[2-(2-chlorophenoxy)acetyl]amino]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NNC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN2O6S/c1-24-16(21)11-6-2-5-9-14(11)26(22,23)19-18-15(20)10-25-13-8-4-3-7-12(13)17/h2-9,19H,10H2,1H3,(H,18,20) |
| InChIKey | MIBCZRPKTWPDSU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|