C18H34O — CID 85078801
5-heptyl-2-hexyl-3-methyl-2,5-dihydrofuran (PubChem CID 85078801) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is 5-heptyl-2-hexyl-3-methyl-2,5-dihydrofuran.
| Compound Name | 5-heptyl-2-hexyl-3-methyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 85078801 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 5-heptyl-2-hexyl-3-methyl-2,5-dihydrofuran |
| SMILES | CCCCCCCC1C=C(C)C(CCCCCC)O1 |
| InChI | InChI=1S/C18H34O/c1-4-6-8-10-11-13-17-15-16(3)18(19-17)14-12-9-7-5-2/h15,17-18H,4-14H2,1-3H3 |
| InChIKey | QGHAAUMCJCLSKJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|