C26H46O8 — CID 85082488
2-[5-[4-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 85082488) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[5-[4-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[5-[4-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85082488 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 2-[5-[4-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpentoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C1CC(O)C2C(C)(CO)CCCC2(C)C1CCC(C)CCOC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C26H46O8/c1-15(8-11-33-24-22(32)21(31)20(30)19(13-27)34-24)6-7-17-16(2)12-18(29)23-25(3,14-28)9-5-10-26(17,23)4/h15,17-24,27-32H,2,5-14H2,1,3-4H3 |
| InChIKey | PQVQAHOMLOTAQL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|