C26H40O4 — CID 85102952
3-(2,4-dimethyl-10-phenyldecyl)-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one (PubChem CID 85102952) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 3-(2,4-dimethyl-10-phenyldecyl)-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one.
| Compound Name | 3-(2,4-dimethyl-10-phenyldecyl)-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 85102952 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 3-(2,4-dimethyl-10-phenyldecyl)-3,4a-dimethyl-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
| SMILES | CC(CCCCCCc1ccccc1)CC(C)CC1(C)CC2(C)OC(=O)CC2OO1 |
| InChI | InChI=1S/C26H40O4/c1-20(12-8-5-6-9-13-22-14-10-7-11-15-22)16-21(2)18-25(3)19-26(4)23(29-30-25)17-24(27)28-26/h7,10-11,14-15,20-21,23H,5-6,8-9,12-13,16-19H2,1-4H3 |
| InChIKey | BFGVFWWNBPNNKE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|