C25H38O4 — CID 85134879
3,4a-dimethyl-3-(2-methyl-10-phenyldecyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one (PubChem CID 85134879) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 3,4a-dimethyl-3-(2-methyl-10-phenyldecyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one.
| Compound Name | 3,4a-dimethyl-3-(2-methyl-10-phenyldecyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 85134879 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 3,4a-dimethyl-3-(2-methyl-10-phenyldecyl)-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
| SMILES | CC(CCCCCCCCc1ccccc1)CC1(C)CC2(C)OC(=O)CC2OO1 |
| InChI | InChI=1S/C25H38O4/c1-20(13-9-6-4-5-7-10-14-21-15-11-8-12-16-21)18-24(2)19-25(3)22(28-29-24)17-23(26)27-25/h8,11-12,15-16,20,22H,4-7,9-10,13-14,17-19H2,1-3H3 |
| InChIKey | OWAXZSHAFBBOBX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|