C20H28N2O3S2 — CID 8513727
2-(1-adamantylsulfanyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 8513727) has the molecular formula C20H28N2O3S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(1-adamantylsulfanyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8513727 |
| Molecular Formula | C20H28N2O3S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CSC12CC3CC(CC(C3)C1)C2)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H28N2O3S2/c1-13(17-2-4-18(5-3-17)27(21,24)25)22-19(23)12-26-20-9-14-6-15(10-20)8-16(7-14)11-20/h2-5,13-16H,6-12H2,1H3,(H,22,23)(H2,21,24,25)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | PMLZRLFKXZRLFN-IVKJLDKCSA-N |
| XLogP | 3.21 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |