C18H16N2O2 — CID 85159146
2-diazo-1,6-diphenylhexane-1,6-dione (PubChem CID 85159146) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-diazo-1,6-diphenylhexane-1,6-dione.
| Compound Name | 2-diazo-1,6-diphenylhexane-1,6-dione |
|---|---|
| PubChem CID | 85159146 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-diazo-1,6-diphenylhexane-1,6-dione |
| SMILES | [N-]=[N+]=C(CCCC(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c19-20-16(18(22)15-10-5-2-6-11-15)12-7-13-17(21)14-8-3-1-4-9-14/h1-6,8-11H,7,12-13H2 |
| InChIKey | WQPGGQRDOCLHNV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|