C16H23O5P — CID 85197708
5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-phenyl-3,4-dihydro-2H-pyran (PubChem CID 85197708) has the molecular formula C16H23O5P and a molecular weight of 326.33 g/mol. Its IUPAC name is 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-phenyl-3,4-dihydro-2H-pyran.
| Compound Name | 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-phenyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 85197708 |
| Molecular Formula | C16H23O5P |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 5-dimethoxyphosphoryl-2-ethoxy-6-methyl-4-phenyl-3,4-dihydro-2H-pyran |
| SMILES | CCOC1CC(c2ccccc2)C(P(=O)(OC)OC)=C(C)O1 |
| InChI | InChI=1S/C16H23O5P/c1-5-20-15-11-14(13-9-7-6-8-10-13)16(12(2)21-15)22(17,18-3)19-4/h6-10,14-15H,5,11H2,1-4H3 |
| InChIKey | RKPKPWJKZRVACS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|