C34H33NO10 — CID 85202353
[4-[(2,3,10,11-tetraacetyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-8-yl)methyl]phenyl] acetate (PubChem CID 85202353) has the molecular formula C34H33NO10 and a molecular weight of 615.64 g/mol. Its IUPAC name is [4-[(2,3,10,11-tetraacetyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-8-yl)methyl]phenyl] acetate.
| Compound Name | [4-[(2,3,10,11-tetraacetyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-8-yl)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 85202353 |
| Molecular Formula | C34H33NO10 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | [4-[(2,3,10,11-tetraacetyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-8-yl)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC2c3cc(OC(C)=O)c(OC(C)=O)cc3CC3c4cc(OC(C)=O)c(OC(C)=O)cc4CCN23)cc1 |
| InChI | InChI=1S/C34H33NO10/c1-18(36)41-26-8-6-23(7-9-26)12-29-28-17-34(45-22(5)40)32(43-20(3)38)15-25(28)13-30-27-16-33(44-21(4)39)31(42-19(2)37)14-24(27)10-11-35(29)30/h6-9,14-17,29-30H,10-13H2,1-5H3 |
| InChIKey | GFABDGCNJRHKIB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|