C13H20O5 — CID 85248151
3,8-dihydroxy-8-(3-hydroxybut-1-enyl)-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 85248151) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,8-dihydroxy-8-(3-hydroxybut-1-enyl)-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | 3,8-dihydroxy-8-(3-hydroxybut-1-enyl)-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 85248151 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3,8-dihydroxy-8-(3-hydroxybut-1-enyl)-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | CC(O)C=CC1(O)C2(C)CC(O)CC1(C)C(=O)O2 |
| InChI | InChI=1S/C13H20O5/c1-8(14)4-5-13(17)11(2)6-9(15)7-12(13,3)18-10(11)16/h4-5,8-9,14-15,17H,6-7H2,1-3H3 |
| InChIKey | AQSPKQLQWIQRJJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|