C13H22O3 — CID 91486610
cis-(4S,5R)-4-hydroxy-4-(3-hydroxybut-1-enyl)-3,3,5-trimethylcyclohexan-1-one (PubChem CID 91486610) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is cis-(4S,5R)-4-hydroxy-4-(3-hydroxybut-1-enyl)-3,3,5-trimethylcyclohexan-1-one.
| Compound Name | cis-(4S,5R)-4-hydroxy-4-(3-hydroxybut-1-enyl)-3,3,5-trimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 91486610 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | cis-(4S,5R)-4-hydroxy-4-(3-hydroxybut-1-enyl)-3,3,5-trimethylcyclohexan-1-one |
| SMILES | CC(O)C=C[C@@]1(O)[C@H](C)CC(=O)CC1(C)C |
| InChI | InChI=1S/C13H22O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-6,9-10,14,16H,7-8H2,1-4H3/t9-,10?,13-/m1/s1 |
| InChIKey | IHDJYDVWNNFPHR-NDAPUWOLSA-N |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|