C18H26O4S — CID 70836100
[(Z)-3-(1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl)but-2-enyl] 2,3-dihydrothiophene-2-carboxylate (PubChem CID 70836100) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is [(Z)-3-(1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl)but-2-enyl] 2,3-dihydrothiophene-2-carboxylate.
| Compound Name | [(Z)-3-(1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl)but-2-enyl] 2,3-dihydrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 70836100 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [(Z)-3-(1-hydroxy-2,2,6-trimethyl-4-oxocyclohexyl)but-2-enyl] 2,3-dihydrothiophene-2-carboxylate |
| SMILES | C/C(=C/COC(=O)C1CC=CS1)C1(O)C(C)CC(=O)CC1(C)C |
| InChI | InChI=1S/C18H26O4S/c1-12(7-8-22-16(20)15-6-5-9-23-15)18(21)13(2)10-14(19)11-17(18,3)4/h5,7,9,13,15,21H,6,8,10-11H2,1-4H3/b12-7- |
| InChIKey | YPJYQHBZGIJJJB-GHXNOFRVSA-N |
| XLogP | 3.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|