C13H22O4 — CID 11265002
(1R,2S,3S,6S)-6-[(E,3S)-3-hydroxybut-1-enyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptane-2,3-diol (PubChem CID 11265002) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (1R,2S,3S,6S)-6-[(E,3S)-3-hydroxybut-1-enyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptane-2,3-diol.
| Compound Name | (1R,2S,3S,6S)-6-[(E,3S)-3-hydroxybut-1-enyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptane-2,3-diol |
|---|---|
| PubChem CID | 11265002 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (1R,2S,3S,6S)-6-[(E,3S)-3-hydroxybut-1-enyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptane-2,3-diol |
| SMILES | C[C@H](O)/C=C/[C@@]12O[C@]1(C)[C@@H](O)[C@@H](O)CC2(C)C |
| InChI | InChI=1S/C13H22O4/c1-8(14)5-6-13-11(2,3)7-9(15)10(16)12(13,4)17-13/h5-6,8-10,14-16H,7H2,1-4H3/b6-5+/t8-,9-,10-,12+,13-/m0/s1 |
| InChIKey | XXTIWEZMRZGAMY-CYPHICCJSA-N |
| XLogP | 0.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|