C20H30O5 — CID 85250186
4-(hydroxymethyl)-4,7,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5,6,7-triol (PubChem CID 85250186) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is 4-(hydroxymethyl)-4,7,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5,6,7-triol.
| Compound Name | 4-(hydroxymethyl)-4,7,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5,6,7-triol |
|---|---|
| PubChem CID | 85250186 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-(hydroxymethyl)-4,7,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5,6,7-triol |
| SMILES | CC1(CO)CCCC2(C)C3Cc4occc4C(C)(O)C3C(O)C(O)C12 |
| InChI | InChI=1S/C20H30O5/c1-18(10-21)6-4-7-19(2)12-9-13-11(5-8-25-13)20(3,24)14(12)15(22)16(23)17(18)19/h5,8,12,14-17,21-24H,4,6-7,9-10H2,1-3H3 |
| InChIKey | QNPNAWLXZOMOPO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |