About methyl 5-bromohex-4-enoate
methyl 5-bromohex-4-enoate (PubChem CID 85272039) has the molecular formula C7H11BrO2
and a molecular weight of 207.07 g/mol. Its IUPAC name is methyl 5-bromohex-4-enoate.
Molecular Properties
| Compound Name | methyl 5-bromohex-4-enoate |
| PubChem CID | 85272039 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | methyl 5-bromohex-4-enoate |
| SMILES | COC(=O)CCC=C(C)Br |
| InChI | InChI=1S/C7H11BrO2/c1-6(8)4-3-5-7(9)10-2/h4H,3,5H2,1-2H3 |
| InChIKey | MRKBOMGZYGBCTM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 5-bromohex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromohex-4-enoate?
The IUPAC name of methyl 5-bromohex-4-enoate (CID 85272039) is methyl 5-bromohex-4-enoate.
What is the SMILES notation for methyl 5-bromohex-4-enoate?
The canonical SMILES for methyl 5-bromohex-4-enoate is COC(=O)CCC=C(C)Br.
What is the InChIKey of methyl 5-bromohex-4-enoate?
The InChIKey is MRKBOMGZYGBCTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrO2/c1-6(8)4-3-5-7(9)10-2/h4H,3,5H2,1-2H3.
What are the key properties of methyl 5-bromohex-4-enoate?
methyl 5-bromohex-4-enoate has a molecular weight of 207.07 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromohex-4-enoate is sourced from PubChem (CID 85272039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).