About 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one
3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 85279921) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one.
Analyze 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one?
The IUPAC name of 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one (CID 85279921) is 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one?
The canonical SMILES for 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one is O=C1C2CCC(C2)C1CC1OCCO1.
What is the InChIKey of 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one?
The InChIKey is JDQNXWADSLZXJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c12-11-8-2-1-7(5-8)9(11)6-10-13-3-4-14-10/h7-10H,1-6H2.
What are the key properties of 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one?
3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one has a molecular weight of 196.25 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxolan-2-ylmethyl)bicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 85279921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).