C19H27N4O3S+ — CID 8531436
1-(4-cyanophenyl)sulfonyl-N-(2-pyrrolidin-1-ium-1-ylethyl)piperidine-4-carboxamide (PubChem CID 8531436) has the molecular formula C19H27N4O3S+ and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-(4-cyanophenyl)sulfonyl-N-(2-pyrrolidin-1-ium-1-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-cyanophenyl)sulfonyl-N-(2-pyrrolidin-1-ium-1-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8531436 |
| Molecular Formula | C19H27N4O3S+ |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-(4-cyanophenyl)sulfonyl-N-(2-pyrrolidin-1-ium-1-ylethyl)piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC(C(=O)NCC[NH+]3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H26N4O3S/c20-15-16-3-5-18(6-4-16)27(25,26)23-12-7-17(8-13-23)19(24)21-9-14-22-10-1-2-11-22/h3-6,17H,1-2,7-14H2,(H,21,24)/p+1 |
| InChIKey | QTHOAERDGGVFAH-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |