About 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine
4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine (PubChem CID 853261) has the molecular formula C19H22N4S
and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine |
| PubChem CID | 853261 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine |
| SMILES | CCN1CCN(c2nc(C)nc3sc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C19H22N4S/c1-3-22-9-11-23(12-10-22)18-16-13-17(15-7-5-4-6-8-15)24-19(16)21-14(2)20-18/h4-8,13H,3,9-12H2,1-2H3 |
| InChIKey | CWQYMWNABHHDQG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine (CID 853261) is 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine is CCN1CCN(c2nc(C)nc3sc(-c4ccccc4)cc23)CC1.
What is the InChIKey of 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine?
The InChIKey is CWQYMWNABHHDQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4S/c1-3-22-9-11-23(12-10-22)18-16-13-17(15-7-5-4-6-8-15)24-19(16)21-14(2)20-18/h4-8,13H,3,9-12H2,1-2H3.
What are the key properties of 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine?
4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine has a molecular weight of 338.48 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylpiperazin-1-yl)-2-methyl-6-phenylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 853261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).