About 4-diazohex-5-en-3-one
4-diazohex-5-en-3-one (PubChem CID 85397160) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 4-diazohex-5-en-3-one.
Molecular Properties
| Compound Name | 4-diazohex-5-en-3-one |
| PubChem CID | 85397160 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 4-diazohex-5-en-3-one |
| SMILES | C=CC(=[N+]=[N-])C(=O)CC |
| InChI | InChI=1S/C6H8N2O/c1-3-5(8-7)6(9)4-2/h3H,1,4H2,2H3 |
| InChIKey | FVKBIPPSMFKRMX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazohex-5-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazohex-5-en-3-one?
The IUPAC name of 4-diazohex-5-en-3-one (CID 85397160) is 4-diazohex-5-en-3-one.
What is the SMILES notation for 4-diazohex-5-en-3-one?
The canonical SMILES for 4-diazohex-5-en-3-one is C=CC(=[N+]=[N-])C(=O)CC.
What is the InChIKey of 4-diazohex-5-en-3-one?
The InChIKey is FVKBIPPSMFKRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-3-5(8-7)6(9)4-2/h3H,1,4H2,2H3.
What are the key properties of 4-diazohex-5-en-3-one?
4-diazohex-5-en-3-one has a molecular weight of 124.14 g/mol, XLogP of 0.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazohex-5-en-3-one is sourced from PubChem (CID 85397160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).