C17H17N3O6 — CID 8543319
2,4-dinitro-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]aniline (PubChem CID 8543319) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is 2,4-dinitro-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]aniline.
| Compound Name | 2,4-dinitro-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]aniline |
|---|---|
| PubChem CID | 8543319 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2,4-dinitro-N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccc(OC[C@@H]3CCCO3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O6/c21-19(22)13-5-8-16(17(10-13)20(23)24)18-12-3-6-14(7-4-12)26-11-15-2-1-9-25-15/h3-8,10,15,18H,1-2,9,11H2/t15-/m0/s1 |
| InChIKey | GNXSNAVIUCAFMR-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|