C24H19ClN2O2 — CID 85470701
N-(5-chloro-2-methylphenyl)-2-(3-hydroxyphenyl)-6-methylquinoline-4-carboxamide (PubChem CID 85470701) has the molecular formula C24H19ClN2O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(3-hydroxyphenyl)-6-methylquinoline-4-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(3-hydroxyphenyl)-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 85470701 |
| Molecular Formula | C24H19ClN2O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(3-hydroxyphenyl)-6-methylquinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3cccc(O)c3)cc(C(=O)Nc3cc(Cl)ccc3C)c2c1 |
| InChI | InChI=1S/C24H19ClN2O2/c1-14-6-9-21-19(10-14)20(13-23(26-21)16-4-3-5-18(28)11-16)24(29)27-22-12-17(25)8-7-15(22)2/h3-13,28H,1-2H3,(H,27,29) |
| InChIKey | HZYJZTJLLSYSPA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |