C17H24N2O5 — CID 85471050
2-hydroxypropanoic acid;propan-2-yl 2-amino-3-(1H-indol-3-yl)propanoate (PubChem CID 85471050) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;propan-2-yl 2-amino-3-(1H-indol-3-yl)propanoate.
| Compound Name | 2-hydroxypropanoic acid;propan-2-yl 2-amino-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 85471050 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-hydroxypropanoic acid;propan-2-yl 2-amino-3-(1H-indol-3-yl)propanoate |
| SMILES | CC(C)OC(=O)C(N)Cc1c[nH]c2ccccc12.CC(O)C(=O)O |
| InChI | InChI=1S/C14H18N2O2.C3H6O3/c1-9(2)18-14(17)12(15)7-10-8-16-13-6-4-3-5-11(10)13;1-2(4)3(5)6/h3-6,8-9,12,16H,7,15H2,1-2H3;2,4H,1H3,(H,5,6) |
| InChIKey | UUOIUYMESKZLCA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |