C21H23ClO7S — CID 85473136
(2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-methylsulfanylphenyl)methyl]-1,3-benzodioxol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 85473136) has the molecular formula C21H23ClO7S and a molecular weight of 454.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-methylsulfanylphenyl)methyl]-1,3-benzodioxol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-methylsulfanylphenyl)methyl]-1,3-benzodioxol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85473136 |
| Molecular Formula | C21H23ClO7S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[7-chloro-6-[(4-methylsulfanylphenyl)methyl]-1,3-benzodioxol-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CSc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2Cl)OCO3)cc1 |
| InChI | InChI=1S/C21H23ClO7S/c1-30-12-4-2-10(3-5-12)6-11-7-13(20-21(15(11)22)28-9-27-20)19-18(26)17(25)16(24)14(8-23)29-19/h2-5,7,14,16-19,23-26H,6,8-9H2,1H3/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | HYVCEAHVHFZTCM-FTWQHDNSSA-N |
| XLogP | 1.90 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |