C19H20BrNO4 — CID 8555502
(2S)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2,4-dimethylphenyl)propanamide (PubChem CID 8555502) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is (2S)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2,4-dimethylphenyl)propanamide.
| Compound Name | (2S)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 8555502 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (2S)-2-(4-bromo-5-formyl-2-methoxyphenoxy)-N-(2,4-dimethylphenyl)propanamide |
| SMILES | COc1cc(Br)c(C=O)cc1O[C@@H](C)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C19H20BrNO4/c1-11-5-6-16(12(2)7-11)21-19(23)13(3)25-18-8-14(10-22)15(20)9-17(18)24-4/h5-10,13H,1-4H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | NZBCMCWMKIDCTJ-ZDUSSCGKSA-N |
| XLogP | 4.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|