C17H30N4S — CID 8560568
(2S)-N-[3-(dimethylamino)propyl]-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide (PubChem CID 8560568) has the molecular formula C17H30N4S and a molecular weight of 322.52 g/mol. Its IUPAC name is (2S)-N-[3-(dimethylamino)propyl]-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide.
| Compound Name | (2S)-N-[3-(dimethylamino)propyl]-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide |
|---|---|
| PubChem CID | 8560568 |
| Molecular Formula | C17H30N4S |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (2S)-N-[3-(dimethylamino)propyl]-2-(1-methylpyrrol-2-yl)azepane-1-carbothioamide |
| SMILES | CN(C)CCCNC(=S)N1CCCCC[C@H]1c1cccn1C |
| InChI | InChI=1S/C17H30N4S/c1-19(2)12-8-11-18-17(22)21-14-6-4-5-9-16(21)15-10-7-13-20(15)3/h7,10,13,16H,4-6,8-9,11-12,14H2,1-3H3,(H,18,22)/t16-/m0/s1 |
| InChIKey | GUCVFEDULVBLNB-INIZCTEOSA-N |
| XLogP | 2.77 |
| TPSA | 23.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|