C17H31N4S+ — CID 8560570
dimethyl-[3-[[(2R)-2-(1-methylpyrrol-2-yl)azepane-1-carbothioyl]amino]propyl]azanium (PubChem CID 8560570) has the molecular formula C17H31N4S+ and a molecular weight of 323.53 g/mol. Its IUPAC name is dimethyl-[3-[[(2R)-2-(1-methylpyrrol-2-yl)azepane-1-carbothioyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[(2R)-2-(1-methylpyrrol-2-yl)azepane-1-carbothioyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 8560570 |
| Molecular Formula | C17H31N4S+ |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | dimethyl-[3-[[(2R)-2-(1-methylpyrrol-2-yl)azepane-1-carbothioyl]amino]propyl]azanium |
| SMILES | Cn1cccc1[C@H]1CCCCCN1C(=S)NCCC[NH+](C)C |
| InChI | InChI=1S/C17H30N4S/c1-19(2)12-8-11-18-17(22)21-14-6-4-5-9-16(21)15-10-7-13-20(15)3/h7,10,13,16H,4-6,8-9,11-12,14H2,1-3H3,(H,18,22)/p+1/t16-/m1/s1 |
| InChIKey | GUCVFEDULVBLNB-MRXNPFEDSA-O |
| XLogP | 1.35 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|