C17H27N3OS — CID 8560479
(2S)-2-(1-methylpyrrol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]azepane-1-carbothioamide (PubChem CID 8560479) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is (2S)-2-(1-methylpyrrol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]azepane-1-carbothioamide.
| Compound Name | (2S)-2-(1-methylpyrrol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]azepane-1-carbothioamide |
|---|---|
| PubChem CID | 8560479 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2S)-2-(1-methylpyrrol-2-yl)-N-[[(2S)-oxolan-2-yl]methyl]azepane-1-carbothioamide |
| SMILES | Cn1cccc1[C@@H]1CCCCCN1C(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H27N3OS/c1-19-10-5-9-15(19)16-8-3-2-4-11-20(16)17(22)18-13-14-7-6-12-21-14/h5,9-10,14,16H,2-4,6-8,11-13H2,1H3,(H,18,22)/t14-,16-/m0/s1 |
| InChIKey | MRPSTZOSCXGZPQ-HOCLYGCPSA-N |
| XLogP | 3.00 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|