C22H26N4O4 — CID 8564674
N-[2-(1H-indol-3-yl)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide (PubChem CID 8564674) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8564674 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-[3-[(1S,2S)-2-methylcyclohexyl]-2,4,5-trioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1N1C(=O)C(=O)N(CC(=O)NCCc2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C22H26N4O4/c1-14-6-2-5-9-18(14)26-21(29)20(28)25(22(26)30)13-19(27)23-11-10-15-12-24-17-8-4-3-7-16(15)17/h3-4,7-8,12,14,18,24H,2,5-6,9-11,13H2,1H3,(H,23,27)/t14-,18-/m0/s1 |
| InChIKey | LAHGBAMVJGZKTL-KSSFIOAISA-N |
| XLogP | 2.20 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|