C21H29F2N3O4 — CID 8571398
N,N-dibutyl-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 8571398) has the molecular formula C21H29F2N3O4 and a molecular weight of 425.48 g/mol. Its IUPAC name is N,N-dibutyl-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N,N-dibutyl-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 8571398 |
| Molecular Formula | C21H29F2N3O4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N,N-dibutyl-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCCCN(CCCC)C(=O)CN1C(=O)N[C@](C)(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C21H29F2N3O4/c1-4-6-12-25(13-7-5-2)17(27)14-26-18(28)21(3,24-20(26)29)15-8-10-16(11-9-15)30-19(22)23/h8-11,19H,4-7,12-14H2,1-3H3,(H,24,29)/t21-/m1/s1 |
| InChIKey | WUNOUMBVDIWOGG-OAQYLSRUSA-N |
| XLogP | 3.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|