C21H21ClN2O4 — CID 8575946
(3-chloro-4-methylquinolin-2-yl)methyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 8575946) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is (3-chloro-4-methylquinolin-2-yl)methyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | (3-chloro-4-methylquinolin-2-yl)methyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 8575946 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (3-chloro-4-methylquinolin-2-yl)methyl (2S)-2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | Cc1c(Cl)c(COC(=O)[C@@H](NC(=O)c2ccco2)C(C)C)nc2ccccc12 |
| InChI | InChI=1S/C21H21ClN2O4/c1-12(2)19(24-20(25)17-9-6-10-27-17)21(26)28-11-16-18(22)13(3)14-7-4-5-8-15(14)23-16/h4-10,12,19H,11H2,1-3H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | GICAIXNUVAGVLU-IBGZPJMESA-N |
| XLogP | 4.29 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |