C28H28N2O5 — CID 4837818
[2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate (PubChem CID 4837818) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is [2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate.
| Compound Name | [2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 4837818 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [2-(1-ethyl-2-phenylindol-3-yl)-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbutanoate |
| SMILES | CCn1c(-c2ccccc2)c(C(=O)COC(=O)C(NC(=O)c2ccco2)C(C)C)c2ccccc21 |
| InChI | InChI=1S/C28H28N2O5/c1-4-30-21-14-9-8-13-20(21)24(26(30)19-11-6-5-7-12-19)22(31)17-35-28(33)25(18(2)3)29-27(32)23-15-10-16-34-23/h5-16,18,25H,4,17H2,1-3H3,(H,29,32) |
| InChIKey | FRVKNKGQJUWILB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |