C19H20N2O5S — CID 8577409
methyl (2S)-4-[2-(2-methylquinoline-4-carbonyl)oxyacetyl]thiomorpholine-2-carboxylate (PubChem CID 8577409) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is methyl (2S)-4-[2-(2-methylquinoline-4-carbonyl)oxyacetyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[2-(2-methylquinoline-4-carbonyl)oxyacetyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 8577409 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | methyl (2S)-4-[2-(2-methylquinoline-4-carbonyl)oxyacetyl]thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)COC(=O)c2cc(C)nc3ccccc23)CCS1 |
| InChI | InChI=1S/C19H20N2O5S/c1-12-9-14(13-5-3-4-6-15(13)20-12)18(23)26-11-17(22)21-7-8-27-16(10-21)19(24)25-2/h3-6,9,16H,7-8,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | WZPZZDOEVIWEKR-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |