C16H16O2 — CID 86010067
2-(2-methoxynaphthalen-1-yl)-3,4-dihydro-2H-pyran (PubChem CID 86010067) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(2-methoxynaphthalen-1-yl)-3,4-dihydro-2H-pyran.
| Compound Name | 2-(2-methoxynaphthalen-1-yl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 86010067 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-(2-methoxynaphthalen-1-yl)-3,4-dihydro-2H-pyran |
| SMILES | COc1ccc2ccccc2c1C1CCC=CO1 |
| InChI | InChI=1S/C16H16O2/c1-17-14-10-9-12-6-2-3-7-13(12)16(14)15-8-4-5-11-18-15/h2-3,5-7,9-11,15H,4,8H2,1H3 |
| InChIKey | UJXQZUHAIOLYEN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |