C18H19ClN4O5 — CID 8601050
[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 8601050) has the molecular formula C18H19ClN4O5 and a molecular weight of 406.83 g/mol. Its IUPAC name is [3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 8601050 |
| Molecular Formula | C18H19ClN4O5 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCc2nc(-c3ccccc3Cl)no2)C1=O |
| InChI | InChI=1S/C18H19ClN4O5/c1-3-18(4-2)16(25)23(17(26)21-18)9-14(24)27-10-13-20-15(22-28-13)11-7-5-6-8-12(11)19/h5-8H,3-4,9-10H2,1-2H3,(H,21,26) |
| InChIKey | KTBNTFSAAWQSQY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|