C2F3NO2 — CID 86016230
1,1,2-trifluoro-2-nitroethene (PubChem CID 86016230) has the molecular formula C2F3NO2 and a molecular weight of 127.02 g/mol. Its IUPAC name is 1,1,2-trifluoro-2-nitroethene.
| Compound Name | 1,1,2-trifluoro-2-nitroethene |
|---|---|
| PubChem CID | 86016230 |
| Molecular Formula | C2F3NO2 |
| Molecular Weight | 127.02 g/mol |
| Exact Mass | 126.99 |
| IUPAC Name | 1,1,2-trifluoro-2-nitroethene |
| SMILES | O=[N+]([O-])C(F)=C(F)F |
| InChI | InChI=1S/C2F3NO2/c3-1(4)2(5)6(7)8 |
| InChIKey | RPVIXCHFPOWUPV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.02 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|