About dinitromethanethione
dinitromethanethione (PubChem CID 154168007) has the molecular formula CN2O4S
and a molecular weight of 136.09 g/mol. Its IUPAC name is dinitromethanethione.
Molecular Properties
| Compound Name | dinitromethanethione |
| PubChem CID | 154168007 |
| Molecular Formula | CN2O4S |
| Molecular Weight | 136.09 g/mol |
| Exact Mass | 135.96 |
| IUPAC Name | dinitromethanethione |
| SMILES | O=[N+]([O-])C(=S)[N+](=O)[O-] |
| InChI | InChI=1S/CN2O4S/c4-2(5)1(8)3(6)7 |
| InChIKey | AQCLIOLMIVZERE-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.09 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dinitromethanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinitromethanethione?
The IUPAC name of dinitromethanethione (CID 154168007) is dinitromethanethione.
What is the SMILES notation for dinitromethanethione?
The canonical SMILES for dinitromethanethione is O=[N+]([O-])C(=S)[N+](=O)[O-].
What is the InChIKey of dinitromethanethione?
The InChIKey is AQCLIOLMIVZERE-UHFFFAOYSA-N. The full InChI is InChI=1S/CN2O4S/c4-2(5)1(8)3(6)7.
What are the key properties of dinitromethanethione?
dinitromethanethione has a molecular weight of 136.09 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dinitromethanethione is sourced from PubChem (CID 154168007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).