C11H10F6N2O2 — CID 86016319
2-cyclopropyl-4,6-bis(2,2,2-trifluoroethoxy)pyrimidine (PubChem CID 86016319) has the molecular formula C11H10F6N2O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 2-cyclopropyl-4,6-bis(2,2,2-trifluoroethoxy)pyrimidine.
| Compound Name | 2-cyclopropyl-4,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
|---|---|
| PubChem CID | 86016319 |
| Molecular Formula | C11H10F6N2O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-cyclopropyl-4,6-bis(2,2,2-trifluoroethoxy)pyrimidine |
| SMILES | FC(F)(F)COc1cc(OCC(F)(F)F)nc(C2CC2)n1 |
| InChI | InChI=1S/C11H10F6N2O2/c12-10(13,14)4-20-7-3-8(21-5-11(15,16)17)19-9(18-7)6-1-2-6/h3,6H,1-2,4-5H2 |
| InChIKey | MOPXHNIVDVYJBN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |