2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid

C17H18O6 — CID 86019281

IUPAC2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid
SMILESCOc1cccc(Oc2cc(OC)c(OC)cc2CC(=O)O)c1
InChIInChI=1S/C17H18O6/c1-20-12-5-4-6-13(9-12)23-14-10-16(22-3)15(21-2)7-11(14)8-17(18)19/h4-7,9-10H,8H2,1-3H3,(H,18,19)
InChIKeyIXYJRVDPWRELOE-UHFFFAOYSA-N
MW318.33 g/mol
LogP3.13
Rot. Bonds7

About 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid

2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid (PubChem CID 86019281) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid.

Molecular Properties

Compound Name2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid
PubChem CID86019281
Molecular FormulaC17H18O6
Molecular Weight318.33 g/mol
Exact Mass318.11
IUPAC Name2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid
SMILESCOc1cccc(Oc2cc(OC)c(OC)cc2CC(=O)O)c1
InChIInChI=1S/C17H18O6/c1-20-12-5-4-6-13(9-12)23-14-10-16(22-3)15(21-2)7-11(14)8-17(18)19/h4-7,9-10H,8H2,1-3H3,(H,18,19)
InChIKeyIXYJRVDPWRELOE-UHFFFAOYSA-N
XLogP3.13
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.33
LogP ≤ 53.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid?
The IUPAC name of 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid (CID 86019281) is 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid.
What is the SMILES notation for 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid?
The canonical SMILES for 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid is COc1cccc(Oc2cc(OC)c(OC)cc2CC(=O)O)c1.
What is the InChIKey of 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid?
The InChIKey is IXYJRVDPWRELOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O6/c1-20-12-5-4-6-13(9-12)23-14-10-16(22-3)15(21-2)7-11(14)8-17(18)19/h4-7,9-10H,8H2,1-3H3,(H,18,19).
What are the key properties of 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid?
2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid has a molecular weight of 318.33 g/mol, XLogP of 3.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethoxy-2-(3-methoxyphenoxy)phenyl]acetic acid is sourced from PubChem (CID 86019281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).