C20H16FNO3S — CID 8602110
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 8602110) has the molecular formula C20H16FNO3S and a molecular weight of 369.42 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8602110 |
| Molecular Formula | C20H16FNO3S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 4-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(O[C@@H](C(=O)NC1CC1)c1ccccc1)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C20H16FNO3S/c21-15-7-4-8-16-14(15)11-17(26-16)20(24)25-18(12-5-2-1-3-6-12)19(23)22-13-9-10-13/h1-8,11,13,18H,9-10H2,(H,22,23)/t18-/m1/s1 |
| InChIKey | SREPICQYLHGQGG-GOSISDBHSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |