C12H11Cl3N2O2 — CID 86031726
3,5-dichloro-N-[3-chloropropoxy(cyano)methyl]benzamide (PubChem CID 86031726) has the molecular formula C12H11Cl3N2O2 and a molecular weight of 321.59 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-chloropropoxy(cyano)methyl]benzamide.
| Compound Name | 3,5-dichloro-N-[3-chloropropoxy(cyano)methyl]benzamide |
|---|---|
| PubChem CID | 86031726 |
| Molecular Formula | C12H11Cl3N2O2 |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 3,5-dichloro-N-[3-chloropropoxy(cyano)methyl]benzamide |
| SMILES | N#CC(NC(=O)c1cc(Cl)cc(Cl)c1)OCCCCl |
| InChI | InChI=1S/C12H11Cl3N2O2/c13-2-1-3-19-11(7-16)17-12(18)8-4-9(14)6-10(15)5-8/h4-6,11H,1-3H2,(H,17,18) |
| InChIKey | JUSPJHGXMGCKNR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|