C11H9F2N3O2 — CID 86031735
N-[acetamido(cyano)methyl]-3,5-difluorobenzamide (PubChem CID 86031735) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is N-[acetamido(cyano)methyl]-3,5-difluorobenzamide.
| Compound Name | N-[acetamido(cyano)methyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 86031735 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[acetamido(cyano)methyl]-3,5-difluorobenzamide |
| SMILES | CC(=O)NC(C#N)NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H9F2N3O2/c1-6(17)15-10(5-14)16-11(18)7-2-8(12)4-9(13)3-7/h2-4,10H,1H3,(H,15,17)(H,16,18) |
| InChIKey | SJFBPTSSJXFBGU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|