C20H16N2O2S — CID 86032331
6-(2-anilino-1,3-thiazol-4-yl)-2,3-dimethylchromen-4-one (PubChem CID 86032331) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 6-(2-anilino-1,3-thiazol-4-yl)-2,3-dimethylchromen-4-one.
| Compound Name | 6-(2-anilino-1,3-thiazol-4-yl)-2,3-dimethylchromen-4-one |
|---|---|
| PubChem CID | 86032331 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 6-(2-anilino-1,3-thiazol-4-yl)-2,3-dimethylchromen-4-one |
| SMILES | Cc1oc2ccc(-c3csc(Nc4ccccc4)n3)cc2c(=O)c1C |
| InChI | InChI=1S/C20H16N2O2S/c1-12-13(2)24-18-9-8-14(10-16(18)19(12)23)17-11-25-20(22-17)21-15-6-4-3-5-7-15/h3-11H,1-2H3,(H,21,22) |
| InChIKey | BCYLVEDQMNOTAV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |