C10H20OSi — CID 86039870
7,7-dimethyl-6-oxa-7-silaspiro[4.5]decane (PubChem CID 86039870) has the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. Its IUPAC name is 7,7-dimethyl-6-oxa-7-silaspiro[4.5]decane.
| Compound Name | 7,7-dimethyl-6-oxa-7-silaspiro[4.5]decane |
|---|---|
| PubChem CID | 86039870 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 7,7-dimethyl-6-oxa-7-silaspiro[4.5]decane |
| SMILES | C[Si]1(C)CCCC2(CCCC2)O1 |
| InChI | InChI=1S/C10H20OSi/c1-12(2)9-5-8-10(11-12)6-3-4-7-10/h3-9H2,1-2H3 |
| InChIKey | GMYNBCDDGSPKDH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|