About methyl 2,3-dihydroxyhexadecanoate
methyl 2,3-dihydroxyhexadecanoate (PubChem CID 86053076) has the molecular formula C17H34O4
and a molecular weight of 302.46 g/mol. Its IUPAC name is methyl 2,3-dihydroxyhexadecanoate.
Molecular Properties
| Compound Name | methyl 2,3-dihydroxyhexadecanoate |
| PubChem CID | 86053076 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | methyl 2,3-dihydroxyhexadecanoate |
| SMILES | CCCCCCCCCCCCCC(O)C(O)C(=O)OC |
| InChI | InChI=1S/C17H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(18)16(19)17(20)21-2/h15-16,18-19H,3-14H2,1-2H3 |
| InChIKey | XOZNUENWVRVWAV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,3-dihydroxyhexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,3-dihydroxyhexadecanoate?
The IUPAC name of methyl 2,3-dihydroxyhexadecanoate (CID 86053076) is methyl 2,3-dihydroxyhexadecanoate.
What is the SMILES notation for methyl 2,3-dihydroxyhexadecanoate?
The canonical SMILES for methyl 2,3-dihydroxyhexadecanoate is CCCCCCCCCCCCCC(O)C(O)C(=O)OC.
What is the InChIKey of methyl 2,3-dihydroxyhexadecanoate?
The InChIKey is XOZNUENWVRVWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(18)16(19)17(20)21-2/h15-16,18-19H,3-14H2,1-2H3.
What are the key properties of methyl 2,3-dihydroxyhexadecanoate?
methyl 2,3-dihydroxyhexadecanoate has a molecular weight of 302.46 g/mol, XLogP of 3.58, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dihydroxyhexadecanoate is sourced from PubChem (CID 86053076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).