C15H27N3 — CID 86054095
2,6-bis(2-methylpropyl)-5-propan-2-ylpyrimidin-4-amine (PubChem CID 86054095) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 2,6-bis(2-methylpropyl)-5-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2,6-bis(2-methylpropyl)-5-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 86054095 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2,6-bis(2-methylpropyl)-5-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)Cc1nc(N)c(C(C)C)c(CC(C)C)n1 |
| InChI | InChI=1S/C15H27N3/c1-9(2)7-12-14(11(5)6)15(16)18-13(17-12)8-10(3)4/h9-11H,7-8H2,1-6H3,(H2,16,17,18) |
| InChIKey | VOOMOIUFLWNALC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |