About p-phenyl benzeneselenol
p-phenyl benzeneselenol (PubChem CID 86061917) has the molecular formula C12H9Se
and a molecular weight of 232.16 g/mol.
Molecular Properties
| Compound Name | p-phenyl benzeneselenol |
| PubChem CID | 86061917 |
| Molecular Formula | C12H9Se |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | — |
| SMILES | [Se]c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9Se/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | SYJSXBAZKKEZMY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze p-phenyl benzeneselenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of p-phenyl benzeneselenol?
The IUPAC name of p-phenyl benzeneselenol (CID 86061917) is not available.
What is the SMILES notation for p-phenyl benzeneselenol?
The canonical SMILES for p-phenyl benzeneselenol is [Se]c1ccc(-c2ccccc2)cc1.
What is the InChIKey of p-phenyl benzeneselenol?
The InChIKey is SYJSXBAZKKEZMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Se/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H.
What are the key properties of p-phenyl benzeneselenol?
p-phenyl benzeneselenol has a molecular weight of 232.16 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for p-phenyl benzeneselenol is sourced from PubChem (CID 86061917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).